C23H34N4O6 — CID 131999712
3-[7-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 131999712) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[7-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 131999712 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-[7-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCCCOCCOCCOCCCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H34N4O6/c24-8-2-10-31-12-14-33-15-13-32-11-3-9-25-19-5-1-4-17-18(19)16-27(23(17)30)20-6-7-21(28)26-22(20)29/h1,4-5,20,25H,2-3,6-16,24H2,(H,26,28,29) |
| InChIKey | IEQGWRKVYZPZDY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|