C34H38N4O8 — CID 149278520
3-[7-[3-[2-[3-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 149278520) has the molecular formula C34H38N4O8 and a molecular weight of 630.70 g/mol. Its IUPAC name is 3-[7-[3-[2-[3-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-[2-[3-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 149278520 |
| Molecular Formula | C34H38N4O8 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 3-[7-[3-[2-[3-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CCCOCCOCCCc4cccc5c4CN([C@H]4CCC(=O)NC4=O)C5=O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C34H38N4O8/c39-29-13-11-27(31(41)35-29)37-19-25-21(5-1-9-23(25)33(37)43)7-3-15-45-17-18-46-16-4-8-22-6-2-10-24-26(22)20-38(34(24)44)28-12-14-30(40)36-32(28)42/h1-2,5-6,9-10,27-28H,3-4,7-8,11-20H2,(H,35,39,41)(H,36,40,42)/t27-,28?/m0/s1 |
| InChIKey | XSMLJRMFBXZZBJ-MBMZGMDYSA-N |
| XLogP | 1.81 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|