C37H41N3O8 — CID 176669691
3-[[5-[3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-1-oxo-4H-naphthalen-2-yl]methyl]piperidine-2,6-dione (PubChem CID 176669691) has the molecular formula C37H41N3O8 and a molecular weight of 655.75 g/mol. Its IUPAC name is 3-[[5-[3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-1-oxo-4H-naphthalen-2-yl]methyl]piperidine-2,6-dione.
| Compound Name | 3-[[5-[3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-1-oxo-4H-naphthalen-2-yl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176669691 |
| Molecular Formula | C37H41N3O8 |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 3-[[5-[3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propoxy]ethoxy]propyl]-1-oxo-4H-naphthalen-2-yl]methyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CC2=CCc3c(CCCOCCOCCCc4cccc5c4CN(C4CCC(=O)NC4=O)C5=O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C37H41N3O8/c41-32-15-12-26(35(44)38-32)21-25-11-13-27-23(5-1-9-28(27)34(25)43)7-3-17-47-19-20-48-18-4-8-24-6-2-10-29-30(24)22-40(37(29)46)31-14-16-33(42)39-36(31)45/h1-2,5-6,9-11,26,31H,3-4,7-8,12-22H2,(H,38,41,44)(H,39,42,45) |
| InChIKey | QHUATERWIQVECX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|