C22H32ClN3O6 — CID 155292375
3-[7-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 155292375) has the molecular formula C22H32ClN3O6 and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-[7-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[7-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 155292375 |
| Molecular Formula | C22H32ClN3O6 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[7-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCCOCCOCCOCCCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H31N3O6.ClH/c23-8-10-30-12-14-31-13-11-29-9-2-4-16-3-1-5-17-18(16)15-25(22(17)28)19-6-7-20(26)24-21(19)27;/h1,3,5,19H,2,4,6-15,23H2,(H,24,26,27);1H |
| InChIKey | GMIGUAHQDNXZHJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|