C29H44N4O8 — CID 162489568
tert-butyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propyl]carbamate (PubChem CID 162489568) has the molecular formula C29H44N4O8 and a molecular weight of 576.69 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 162489568 |
| Molecular Formula | C29H44N4O8 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCN |
| InChI | InChI=1S/C29H44N4O8/c1-29(2,3)41-28(37)32(13-15-39-17-19-40-18-16-38-14-11-30)12-5-7-21-6-4-8-22-23(21)20-33(27(22)36)24-9-10-25(34)31-26(24)35/h4,6,8,24H,5,7,9-20,30H2,1-3H3,(H,31,34,35) |
| InChIKey | RNORWWZAOVEANY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|