C30H41N3O9 — CID 160997619
tert-butyl N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 160997619) has the molecular formula C30H41N3O9 and a molecular weight of 587.67 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 160997619 |
| Molecular Formula | C30H41N3O9 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | tert-butyl N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCO |
| InChI | InChI=1S/C30H41N3O9/c1-30(2,3)42-29(38)32(13-15-39-17-19-41-20-18-40-16-14-34)12-5-4-7-22-8-6-9-23-24(22)21-33(28(23)37)25-10-11-26(35)31-27(25)36/h6,8-9,25,34H,5,10-21H2,1-3H3,(H,31,35,36) |
| InChIKey | TVLMRQWHIYEWKH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|