C32H45N3O10 — CID 156735932
tert-butyl N-[2-[2-[2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-methylcarbamate (PubChem CID 156735932) has the molecular formula C32H45N3O10 and a molecular weight of 631.72 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 156735932 |
| Molecular Formula | C32H45N3O10 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOCCOCCOCCOCCOCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45N3O10/c1-32(2,3)45-31(39)34(4)12-14-41-16-18-43-20-22-44-21-19-42-17-15-40-13-6-8-24-7-5-9-25-26(24)23-35(30(25)38)27-10-11-28(36)33-29(27)37/h5,7,9,27H,10-23H2,1-4H3,(H,33,36,37) |
| InChIKey | AVZBZIVQWVHAMZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|