C30H40N6O8 — CID 168832876
tert-butyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]carbamate (PubChem CID 168832876) has the molecular formula C30H40N6O8 and a molecular weight of 612.68 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 168832876 |
| Molecular Formula | C30H40N6O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C30H40N6O8/c1-30(2,3)44-29(40)35(14-16-42-18-20-43-19-17-41-15-12-32-34-31)13-5-4-7-22-8-6-9-23-24(22)21-36(28(23)39)25-10-11-26(37)33-27(25)38/h6,8-9,25H,5,10-21H2,1-3H3,(H,33,37,38) |
| InChIKey | WHITXMXPAAUAIY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|