C28H38N4O7 — CID 159443889
tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate (PubChem CID 159443889) has the molecular formula C28H38N4O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 159443889 |
| Molecular Formula | C28H38N4O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC#Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCN |
| InChI | InChI=1S/C28H38N4O7/c1-28(2,3)39-27(36)31(13-15-38-17-16-37-14-11-29)12-5-4-6-20-7-8-22-21(18-20)19-32(26(22)35)23-9-10-24(33)30-25(23)34/h7-8,18,23H,5,9-17,19,29H2,1-3H3,(H,30,33,34) |
| InChIKey | LSNADQWQMOAMBM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|