C23H27N3O8 — CID 170309836
2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 170309836) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is 2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 170309836 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOCC#Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H27N3O8/c27-20-6-5-19(21(28)25-20)26-15-17-14-16(3-4-18(17)22(26)29)2-1-8-32-10-12-34-13-11-33-9-7-24-23(30)31/h3-4,14,19,24H,5-13,15H2,(H,30,31)(H,25,27,28) |
| InChIKey | DRWHRFPGCRFSHZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|