C22H25N3O7 — CID 165369330
5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]prop-1-ynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 165369330) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]prop-1-ynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]prop-1-ynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 165369330 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]prop-1-ynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCCOCCOCCOCC#Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H25N3O7/c23-7-9-31-11-13-32-12-10-30-8-1-2-15-3-4-16-17(14-15)22(29)25(21(16)28)18-5-6-19(26)24-20(18)27/h3-4,14,18H,5-13,23H2,(H,24,26,27) |
| InChIKey | DAGZQZBDPNSIDW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|