C18H16N2O5 — CID 138695542
2-(2,6-dioxopiperidin-3-yl)-5-(5-hydroxypent-1-ynyl)isoindole-1,3-dione (PubChem CID 138695542) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(5-hydroxypent-1-ynyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(5-hydroxypent-1-ynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138695542 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(5-hydroxypent-1-ynyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C#CCCCO)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H16N2O5/c21-9-3-1-2-4-11-5-6-12-13(10-11)18(25)20(17(12)24)14-7-8-15(22)19-16(14)23/h5-6,10,14,21H,1,3,7-9H2,(H,19,22,23) |
| InChIKey | ZJGYLKVBITYYHB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|