C13H9N3O5 — CID 163290580
2-(2,6-dioxopiperidin-3-yl)-5-nitrosoisoindole-1,3-dione (PubChem CID 163290580) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-nitrosoisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-nitrosoisoindole-1,3-dione |
|---|---|
| PubChem CID | 163290580 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-nitrosoisoindole-1,3-dione |
| SMILES | O=Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H9N3O5/c17-10-4-3-9(11(18)14-10)16-12(19)7-2-1-6(15-21)5-8(7)13(16)20/h1-2,5,9H,3-4H2,(H,14,17,18) |
| InChIKey | NTNGVYDKDUGPDM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|