C15H16N2O4 — CID 91469620
2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;ethane (PubChem CID 91469620) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;ethane.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 91469620 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O4.C2H6/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;1-2/h1-4,9H,5-6H2,(H,14,16,17);1-2H3 |
| InChIKey | WOTBBVGIFQHWLO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|