C21H18N2O12 — CID 175735508
bis((E)-but-2-enedioic acid);2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175735508) has the molecular formula C21H18N2O12 and a molecular weight of 490.38 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | bis((E)-but-2-enedioic acid);2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175735508 |
| Molecular Formula | C21H18N2O12 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O4.2C4H4O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;2*5-3(6)1-2-4(7)8/h1-4,9H,5-6H2,(H,14,16,17);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | SEGGAVAVLPXJKK-LVEZLNDCSA-N |
| XLogP | -0.49 |
| TPSA | 232.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|