C21H16N2O5 — CID 46230589
4-(4-acetylphenyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 46230589) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-(4-acetylphenyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(4-acetylphenyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 46230589 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-(4-acetylphenyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(=O)c1ccc(-c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C21H16N2O5/c1-11(24)12-5-7-13(8-6-12)14-3-2-4-15-18(14)21(28)23(20(15)27)16-9-10-17(25)22-19(16)26/h2-8,16H,9-10H2,1H3,(H,22,25,26) |
| InChIKey | MVVWGUDIGBQFKP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|