C14H12IN2O4- — CID 156883025
2-(2,6-dioxopiperidin-3-yl)-4-methyliodanuidylisoindole-1,3-dione (PubChem CID 156883025) has the molecular formula C14H12IN2O4- and a molecular weight of 399.16 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-methyliodanuidylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-methyliodanuidylisoindole-1,3-dione |
|---|---|
| PubChem CID | 156883025 |
| Molecular Formula | C14H12IN2O4- |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-methyliodanuidylisoindole-1,3-dione |
| SMILES | C[I-]c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H12IN2O4/c1-15-8-4-2-3-7-11(8)14(21)17(13(7)20)9-5-6-10(18)16-12(9)19/h2-4,9H,5-6H2,1H3,(H,16,18,19)/q-1 |
| InChIKey | RLFKXWWHJKPUTA-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|