C27H26N6O8 — CID 160955629
4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;methanamine (PubChem CID 160955629) has the molecular formula C27H26N6O8 and a molecular weight of 562.54 g/mol. Its IUPAC name is 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;methanamine.
| Compound Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;methanamine |
|---|---|
| PubChem CID | 160955629 |
| Molecular Formula | C27H26N6O8 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;methanamine |
| SMILES | CN.Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H11N3O4.C13H10N2O4.CH5N/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18;16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;1-2/h1-3,8H,4-5,14H2,(H,15,17,18);1-4,9H,5-6H2,(H,14,16,17);2H2,1H3 |
| InChIKey | SWIPMWKABWETOL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 219.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|