C13H15N3O6 — CID 135349767
4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrate (PubChem CID 135349767) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrate.
| Compound Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrate |
|---|---|
| PubChem CID | 135349767 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrate |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O.O |
| InChI | InChI=1S/C13H11N3O4.2H2O/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18;;/h1-3,8H,4-5,14H2,(H,15,17,18);2*1H2 |
| InChIKey | JSNWXKGXGRDDRD-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|