C13H11N3O6S — CID 154689780
2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-sulfonamide (PubChem CID 154689780) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-sulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-sulfonamide |
|---|---|
| PubChem CID | 154689780 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H11N3O6S/c14-23(21,22)8-3-1-2-6-10(8)13(20)16(12(6)19)7-4-5-9(17)15-11(7)18/h1-3,7H,4-5H2,(H2,14,21,22)(H,15,17,18) |
| InChIKey | DKZXFLGOWQUQTA-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|