C19H21IN2O6S — CID 151673072
2-(2,6-dioxopiperidin-3-yl)-4-(6-iodohexylsulfonyl)isoindole-1,3-dione (PubChem CID 151673072) has the molecular formula C19H21IN2O6S and a molecular weight of 532.36 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(6-iodohexylsulfonyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(6-iodohexylsulfonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 151673072 |
| Molecular Formula | C19H21IN2O6S |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(6-iodohexylsulfonyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(S(=O)(=O)CCCCCCI)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H21IN2O6S/c20-10-3-1-2-4-11-29(27,28)14-7-5-6-12-16(14)19(26)22(18(12)25)13-8-9-15(23)21-17(13)24/h5-7,13H,1-4,8-11H2,(H,21,23,24) |
| InChIKey | QYYRLOTZEOOEFO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|