C19H20N2O10S — CID 153351889
2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]acetic acid (PubChem CID 153351889) has the molecular formula C19H20N2O10S and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 153351889 |
| Molecular Formula | C19H20N2O10S |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCS(=O)(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H20N2O10S/c22-14-5-4-12(17(25)20-14)21-18(26)11-2-1-3-13(16(11)19(21)27)32(28,29)9-8-30-6-7-31-10-15(23)24/h1-3,12H,4-10H2,(H,23,24)(H,20,22,25) |
| InChIKey | ZSPMXADQDMMPFQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|