C20H22N2O10S — CID 153351501
3-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]propanoic acid (PubChem CID 153351501) has the molecular formula C20H22N2O10S and a molecular weight of 482.47 g/mol. Its IUPAC name is 3-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 153351501 |
| Molecular Formula | C20H22N2O10S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 3-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfonylethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCS(=O)(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H22N2O10S/c23-15-5-4-13(18(26)21-15)22-19(27)12-2-1-3-14(17(12)20(22)28)33(29,30)11-10-32-9-8-31-7-6-16(24)25/h1-3,13H,4-11H2,(H,24,25)(H,21,23,26) |
| InChIKey | LSEJYNYFNOVIOX-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|