C14H12N2O6S — CID 150998829
2-(2,6-dioxopiperidin-3-yl)-4-methylsulfonylisoindole-1,3-dione (PubChem CID 150998829) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-methylsulfonylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-methylsulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 150998829 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-methylsulfonylisoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H12N2O6S/c1-23(21,22)9-4-2-3-7-11(9)14(20)16(13(7)19)8-5-6-10(17)15-12(8)18/h2-4,8H,5-6H2,1H3,(H,15,17,18) |
| InChIKey | LTRDPARQAWWFNZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|