C15H13IN2O6S — CID 152675638
2-(2,6-dioxopiperidin-3-yl)-4-(2-iodoethylsulfonyl)isoindole-1,3-dione (PubChem CID 152675638) has the molecular formula C15H13IN2O6S and a molecular weight of 476.25 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-iodoethylsulfonyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-iodoethylsulfonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 152675638 |
| Molecular Formula | C15H13IN2O6S |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-iodoethylsulfonyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(S(=O)(=O)CCI)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H13IN2O6S/c16-6-7-25(23,24)10-3-1-2-8-12(10)15(22)18(14(8)21)9-4-5-11(19)17-13(9)20/h1-3,9H,4-7H2,(H,17,19,20) |
| InChIKey | ZMLMQSIKUCVHKY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|