C14H13N3O4 — CID 172771986
8-amino-2-(2,6-dioxopiperidin-3-yl)-4H-isoquinoline-1,3-dione (PubChem CID 172771986) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 8-amino-2-(2,6-dioxopiperidin-3-yl)-4H-isoquinoline-1,3-dione.
| Compound Name | 8-amino-2-(2,6-dioxopiperidin-3-yl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 172771986 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 8-amino-2-(2,6-dioxopiperidin-3-yl)-4H-isoquinoline-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C(=O)C2 |
| InChI | InChI=1S/C14H13N3O4/c15-8-3-1-2-7-6-11(19)17(14(21)12(7)8)9-4-5-10(18)16-13(9)20/h1-3,9H,4-6,15H2,(H,16,18,20) |
| InChIKey | NBTXMVRBQILMLF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|