C28H24N4O10 — CID 158666282
2-(2,6-dioxopiperidin-3-yl)-4-methoxyisoindole-1,3-dione (PubChem CID 158666282) has the molecular formula C28H24N4O10 and a molecular weight of 576.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-methoxyisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-methoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 158666282 |
| Molecular Formula | C28H24N4O10 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-methoxyisoindole-1,3-dione |
| SMILES | COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/2C14H12N2O5/c2*1-21-9-4-2-3-7-11(9)14(20)16(13(7)19)8-5-6-10(17)15-12(8)18/h2*2-4,8H,5-6H2,1H3,(H,15,17,18) |
| InChIKey | IDJWIZXKCLFNBA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|