C21H19N3O6 — CID 58827357
4-(2,5-dimethoxyanilino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 58827357) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is 4-(2,5-dimethoxyanilino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(2,5-dimethoxyanilino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58827357 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-(2,5-dimethoxyanilino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1ccc(OC)c(Nc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C21H19N3O6/c1-29-11-6-8-16(30-2)14(10-11)22-13-5-3-4-12-18(13)21(28)24(20(12)27)15-7-9-17(25)23-19(15)26/h3-6,8,10,15,22H,7,9H2,1-2H3,(H,23,25,26) |
| InChIKey | FQOBRIMZERWFKV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|