C21H18N2O5 — CID 58307217
2-(2,4-dioxocyclohexyl)-4-(2-methoxyanilino)isoindole-1,3-dione (PubChem CID 58307217) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-(2-methoxyanilino)isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-(2-methoxyanilino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58307217 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-(2-methoxyanilino)isoindole-1,3-dione |
| SMILES | COc1ccccc1Nc1cccc2c1C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C21H18N2O5/c1-28-18-8-3-2-6-14(18)22-15-7-4-5-13-19(15)21(27)23(20(13)26)16-10-9-12(24)11-17(16)25/h2-8,16,22H,9-11H2,1H3 |
| InChIKey | DBPCGCZDERGFEX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|