C27H30ClN3O7 — CID 123692757
2-(2,4-dioxocyclohexyl)-4-[2-methoxy-4-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione;hydrochloride (PubChem CID 123692757) has the molecular formula C27H30ClN3O7 and a molecular weight of 544.00 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[2-methoxy-4-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[2-methoxy-4-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 123692757 |
| Molecular Formula | C27H30ClN3O7 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[2-methoxy-4-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione;hydrochloride |
| SMILES | COc1cc(OCCN2CCOCC2)ccc1Nc1cccc2c1C(=O)N(C1CCC(=O)CC1=O)C2=O.Cl |
| InChI | InChI=1S/C27H29N3O7.ClH/c1-35-24-16-18(37-14-11-29-9-12-36-13-10-29)6-7-20(24)28-21-4-2-3-19-25(21)27(34)30(26(19)33)22-8-5-17(31)15-23(22)32;/h2-4,6-7,16,22,28H,5,8-15H2,1H3;1H |
| InChIKey | DXSUZCBVUUTNBL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|