C21H24N2O6 — CID 141169733
3-[2-methoxy-4-(2-pyrrolidin-1-ylethoxy)anilino]phthalic acid (PubChem CID 141169733) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-[2-methoxy-4-(2-pyrrolidin-1-ylethoxy)anilino]phthalic acid.
| Compound Name | 3-[2-methoxy-4-(2-pyrrolidin-1-ylethoxy)anilino]phthalic acid |
|---|---|
| PubChem CID | 141169733 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-[2-methoxy-4-(2-pyrrolidin-1-ylethoxy)anilino]phthalic acid |
| SMILES | COc1cc(OCCN2CCCC2)ccc1Nc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C21H24N2O6/c1-28-18-13-14(29-12-11-23-9-2-3-10-23)7-8-16(18)22-17-6-4-5-15(20(24)25)19(17)21(26)27/h4-8,13,22H,2-3,9-12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | ZDLMXMFLDAMAIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |