C22H26N2O6 — CID 58307153
dimethyl 3-[3-(2-morpholin-4-ylethoxy)anilino]benzene-1,2-dicarboxylate (PubChem CID 58307153) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is dimethyl 3-[3-(2-morpholin-4-ylethoxy)anilino]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[3-(2-morpholin-4-ylethoxy)anilino]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58307153 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | dimethyl 3-[3-(2-morpholin-4-ylethoxy)anilino]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(Nc2cccc(OCCN3CCOCC3)c2)c1C(=O)OC |
| InChI | InChI=1S/C22H26N2O6/c1-27-21(25)18-7-4-8-19(20(18)22(26)28-2)23-16-5-3-6-17(15-16)30-14-11-24-9-12-29-13-10-24/h3-8,15,23H,9-14H2,1-2H3 |
| InChIKey | ITECIRMFZYCFRG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |