C22H37ClN2O4 — CID 3087063
2-morpholin-4-ylethyl N-(3-nonoxyphenyl)carbamate;hydrochloride (PubChem CID 3087063) has the molecular formula C22H37ClN2O4 and a molecular weight of 429.00 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N-(3-nonoxyphenyl)carbamate;hydrochloride.
| Compound Name | 2-morpholin-4-ylethyl N-(3-nonoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 3087063 |
| Molecular Formula | C22H37ClN2O4 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-morpholin-4-ylethyl N-(3-nonoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCCCCCOc1cccc(NC(=O)OCCN2CCOCC2)c1.Cl |
| InChI | InChI=1S/C22H36N2O4.ClH/c1-2-3-4-5-6-7-8-15-27-21-11-9-10-20(19-21)23-22(25)28-18-14-24-12-16-26-17-13-24;/h9-11,19H,2-8,12-18H2,1H3,(H,23,25);1H |
| InChIKey | SZWXCSZYZINZTM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|