C21H27ClN2O3 — CID 138398426
2-piperidin-1-ylethyl N-(3-phenylmethoxyphenyl)carbamate;hydrochloride (PubChem CID 138398426) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl N-(3-phenylmethoxyphenyl)carbamate;hydrochloride.
| Compound Name | 2-piperidin-1-ylethyl N-(3-phenylmethoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 138398426 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-piperidin-1-ylethyl N-(3-phenylmethoxyphenyl)carbamate;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(OCc2ccccc2)c1)OCCN1CCCCC1 |
| InChI | InChI=1S/C21H26N2O3.ClH/c24-21(25-15-14-23-12-5-2-6-13-23)22-19-10-7-11-20(16-19)26-17-18-8-3-1-4-9-18;/h1,3-4,7-11,16H,2,5-6,12-15,17H2,(H,22,24);1H |
| InChIKey | BSJQPARZZHJHGM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |