C21H26N2O3 — CID 11035624
3-piperidin-1-ylpropyl N-(4-phenoxyphenyl)carbamate (PubChem CID 11035624) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl N-(4-phenoxyphenyl)carbamate.
| Compound Name | 3-piperidin-1-ylpropyl N-(4-phenoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11035624 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-piperidin-1-ylpropyl N-(4-phenoxyphenyl)carbamate |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)OCCCN1CCCCC1 |
| InChI | InChI=1S/C21H26N2O3/c24-21(25-17-7-16-23-14-5-2-6-15-23)22-18-10-12-20(13-11-18)26-19-8-3-1-4-9-19/h1,3-4,8-13H,2,5-7,14-17H2,(H,22,24) |
| InChIKey | KAUBXMGXTBANBP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|