C16H23ClN2O3 — CID 45048307
2-piperidin-1-ylethyl N-(4-acetylphenyl)carbamate;hydrochloride (PubChem CID 45048307) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl N-(4-acetylphenyl)carbamate;hydrochloride.
| Compound Name | 2-piperidin-1-ylethyl N-(4-acetylphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 45048307 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-piperidin-1-ylethyl N-(4-acetylphenyl)carbamate;hydrochloride |
| SMILES | CC(=O)c1ccc(NC(=O)OCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-13(19)14-5-7-15(8-6-14)17-16(20)21-12-11-18-9-3-2-4-10-18;/h5-8H,2-4,9-12H2,1H3,(H,17,20);1H |
| InChIKey | JKVBNXDFGPXTFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |