About methyl N-(4-acetylphenyl)carbamate;propane
methyl N-(4-acetylphenyl)carbamate;propane (PubChem CID 177246404) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl N-(4-acetylphenyl)carbamate;propane.
Molecular Properties
| Compound Name | methyl N-(4-acetylphenyl)carbamate;propane |
| PubChem CID | 177246404 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl N-(4-acetylphenyl)carbamate;propane |
| SMILES | CCC.COC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C10H11NO3.C3H8/c1-7(12)8-3-5-9(6-4-8)11-10(13)14-2;1-3-2/h3-6H,1-2H3,(H,11,13);3H2,1-2H3 |
| InChIKey | UHVUPSFCURWBAZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-(4-acetylphenyl)carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4-acetylphenyl)carbamate;propane?
The IUPAC name of methyl N-(4-acetylphenyl)carbamate;propane (CID 177246404) is methyl N-(4-acetylphenyl)carbamate;propane.
What is the SMILES notation for methyl N-(4-acetylphenyl)carbamate;propane?
The canonical SMILES for methyl N-(4-acetylphenyl)carbamate;propane is CCC.COC(=O)Nc1ccc(C(C)=O)cc1.
What is the InChIKey of methyl N-(4-acetylphenyl)carbamate;propane?
The InChIKey is UHVUPSFCURWBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3.C3H8/c1-7(12)8-3-5-9(6-4-8)11-10(13)14-2;1-3-2/h3-6H,1-2H3,(H,11,13);3H2,1-2H3.
What are the key properties of methyl N-(4-acetylphenyl)carbamate;propane?
methyl N-(4-acetylphenyl)carbamate;propane has a molecular weight of 237.30 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4-acetylphenyl)carbamate;propane is sourced from PubChem (CID 177246404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).