About [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate
[(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate (PubChem CID 125485467) has the molecular formula C12H14ClNO3
and a molecular weight of 255.70 g/mol. Its IUPAC name is [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate.
Molecular Properties
| Compound Name | [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate |
| PubChem CID | 125485467 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)OC[C@H](C)Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO3/c1-8(13)7-17-12(16)14-11-5-3-10(4-6-11)9(2)15/h3-6,8H,7H2,1-2H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | OBNADNJITLMHHJ-QMMMGPOBSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate?
The IUPAC name of [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate (CID 125485467) is [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate.
What is the SMILES notation for [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate?
The canonical SMILES for [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate is CC(=O)c1ccc(NC(=O)OC[C@H](C)Cl)cc1.
What is the InChIKey of [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate?
The InChIKey is OBNADNJITLMHHJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H14ClNO3/c1-8(13)7-17-12(16)14-11-5-3-10(4-6-11)9(2)15/h3-6,8H,7H2,1-2H3,(H,14,16)/t8-/m0/s1.
What are the key properties of [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate?
[(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate has a molecular weight of 255.70 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-chloropropyl] N-(4-acetylphenyl)carbamate is sourced from PubChem (CID 125485467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).