C16H25ClN2O3 — CID 24836577
ethyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride (PubChem CID 24836577) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is ethyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 24836577 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)Nc1ccc(OCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O3.ClH/c1-2-20-16(19)17-14-6-8-15(9-7-14)21-13-12-18-10-4-3-5-11-18;/h6-9H,2-5,10-13H2,1H3,(H,17,19);1H |
| InChIKey | KFYWONDYFCCVMD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |