C16H21Cl3N2O2 — CID 100689409
N-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2,2,2-trichloroacetamide (PubChem CID 100689409) has the molecular formula C16H21Cl3N2O2 and a molecular weight of 379.72 g/mol. Its IUPAC name is N-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 100689409 |
| Molecular Formula | C16H21Cl3N2O2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1ccc(OCCN2CCCCCC2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3N2O2/c17-16(18,19)15(22)20-13-5-7-14(8-6-13)23-12-11-21-9-3-1-2-4-10-21/h5-8H,1-4,9-12H2,(H,20,22) |
| InChIKey | HUBKJIIXIGMRMW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|