C22H27N3O4 — CID 122087184
4-[[[4-(2-piperidin-1-ylethoxy)phenyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122087184) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[[[4-(2-piperidin-1-ylethoxy)phenyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[4-(2-piperidin-1-ylethoxy)phenyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122087184 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[[[4-(2-piperidin-1-ylethoxy)phenyl]carbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)cc1)Nc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c26-21(27)18-6-4-17(5-7-18)16-23-22(28)24-19-8-10-20(11-9-19)29-15-14-25-12-2-1-3-13-25/h4-11H,1-3,12-16H2,(H,26,27)(H2,23,24,28) |
| InChIKey | UAWSAIFZEYXQKL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |