C29H32N6O2 — CID 50898684
1-benzyl-3-[4-[[7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea (PubChem CID 50898684) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 1-benzyl-3-[4-[[7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[[7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 50898684 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 1-benzyl-3-[4-[[7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc(Nc2ncnc3cc(OCCCN4CCCC4)ccc23)cc1 |
| InChI | InChI=1S/C29H32N6O2/c36-29(30-20-22-7-2-1-3-8-22)34-24-11-9-23(10-12-24)33-28-26-14-13-25(19-27(26)31-21-32-28)37-18-6-17-35-15-4-5-16-35/h1-3,7-14,19,21H,4-6,15-18,20H2,(H2,30,34,36)(H,31,32,33) |
| InChIKey | CZXWODTUMHNHMA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|