C32H39N6O6P — CID 59268791
[1-[3-[4-[2-[4-(phenylcarbamoylamino)phenyl]ethylamino]quinazolin-7-yl]oxypropyl]piperidin-4-yl]methyl dihydrogen phosphate (PubChem CID 59268791) has the molecular formula C32H39N6O6P and a molecular weight of 634.67 g/mol. Its IUPAC name is [1-[3-[4-[2-[4-(phenylcarbamoylamino)phenyl]ethylamino]quinazolin-7-yl]oxypropyl]piperidin-4-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[3-[4-[2-[4-(phenylcarbamoylamino)phenyl]ethylamino]quinazolin-7-yl]oxypropyl]piperidin-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59268791 |
| Molecular Formula | C32H39N6O6P |
| Molecular Weight | 634.67 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | [1-[3-[4-[2-[4-(phenylcarbamoylamino)phenyl]ethylamino]quinazolin-7-yl]oxypropyl]piperidin-4-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(CCNc2ncnc3cc(OCCCN4CCC(COP(=O)(O)O)CC4)ccc23)cc1 |
| InChI | InChI=1S/C32H39N6O6P/c39-32(36-26-5-2-1-3-6-26)37-27-9-7-24(8-10-27)13-16-33-31-29-12-11-28(21-30(29)34-23-35-31)43-20-4-17-38-18-14-25(15-19-38)22-44-45(40,41)42/h1-3,5-12,21,23,25H,4,13-20,22H2,(H,33,34,35)(H2,36,37,39)(H2,40,41,42) |
| InChIKey | BDHDVPSPQMJSPC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 158.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|