C27H31FN7O6P — CID 10008707
[(2S)-1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 10008707) has the molecular formula C27H31FN7O6P and a molecular weight of 599.56 g/mol. Its IUPAC name is [(2S)-1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S)-1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10008707 |
| Molecular Formula | C27H31FN7O6P |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | [(2S)-1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Cc1cc(Nc2ncnc3cc(OCCCN4CCC[C@H]4COP(=O)(O)O)ccc23)n[nH]1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C27H31FN7O6P/c28-18-4-1-5-19(12-18)31-26(36)14-20-13-25(34-33-20)32-27-23-8-7-22(15-24(23)29-17-30-27)40-11-3-10-35-9-2-6-21(35)16-41-42(37,38)39/h1,4-5,7-8,12-13,15,17,21H,2-3,6,9-11,14,16H2,(H,31,36)(H2,37,38,39)(H2,29,30,32,33,34)/t21-/m0/s1 |
| InChIKey | DFACNMGLGARRJJ-NRFANRHFSA-N |
| XLogP | 3.76 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|