C35H49FN7O6P — CID 68662784
ditert-butyl [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] phosphate (PubChem CID 68662784) has the molecular formula C35H49FN7O6P and a molecular weight of 713.79 g/mol. Its IUPAC name is ditert-butyl [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] phosphate.
| Compound Name | ditert-butyl [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] phosphate |
|---|---|
| PubChem CID | 68662784 |
| Molecular Formula | C35H49FN7O6P |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.35 |
| IUPAC Name | ditert-butyl [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] phosphate |
| SMILES | CC(C)(CCOP(=O)(OC(C)(C)C)OC(C)(C)C)NCCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C35H49FN7O6P/c1-33(2,3)48-50(45,49-34(4,5)6)47-18-15-35(7,8)39-16-10-17-46-27-13-14-28-29(22-27)37-23-38-32(28)41-30-20-26(42-43-30)21-31(44)40-25-12-9-11-24(36)19-25/h9,11-14,19-20,22-23,39H,10,15-18,21H2,1-8H3,(H,40,44)(H2,37,38,41,42,43) |
| InChIKey | SZXGOZVJRYGGAK-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 161.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|