C24H24ClFN6O4 — CID 68538646
2-[3-[[5-(2-chloroethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 68538646) has the molecular formula C24H24ClFN6O4 and a molecular weight of 514.95 g/mol. Its IUPAC name is 2-[3-[[5-(2-chloroethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[3-[[5-(2-chloroethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 68538646 |
| Molecular Formula | C24H24ClFN6O4 |
| Molecular Weight | 514.95 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[3-[[5-(2-chloroethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COCCOc1cc(OCCCl)c2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C24H24ClFN6O4/c1-34-7-8-35-18-12-19-23(20(13-18)36-6-5-25)24(28-14-27-19)30-21-10-17(31-32-21)11-22(33)29-16-4-2-3-15(26)9-16/h2-4,9-10,12-14H,5-8,11H2,1H3,(H,29,33)(H2,27,28,30,31,32) |
| InChIKey | NXUSNXBRLUFWGA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|