C29H35FN7O7P — CID 154455992
[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino] ethyl hydrogen phosphate (PubChem CID 154455992) has the molecular formula C29H35FN7O7P and a molecular weight of 643.61 g/mol. Its IUPAC name is [cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino] ethyl hydrogen phosphate.
| Compound Name | [cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino] ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 154455992 |
| Molecular Formula | C29H35FN7O7P |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | [cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)ON(CCCOc1cc2ncnc(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)c2cc1OC)C1CCC1 |
| InChI | InChI=1S/C29H35FN7O7P/c1-3-43-45(39,40)44-37(22-9-5-10-22)11-6-12-42-26-17-24-23(16-25(26)41-2)29(32-18-31-24)34-27-14-21(35-36-27)15-28(38)33-20-8-4-7-19(30)13-20/h4,7-8,13-14,16-18,22H,3,5-6,9-12,15H2,1-2H3,(H,33,38)(H,39,40)(H2,31,32,34,35,36) |
| InChIKey | JNDPIVMMTQPZHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|