C36H48FN7O3 — CID 173170922
2-[3-[[7-[3-(2,2-ditert-butylpiperidin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 173170922) has the molecular formula C36H48FN7O3 and a molecular weight of 645.82 g/mol. Its IUPAC name is 2-[3-[[7-[3-(2,2-ditert-butylpiperidin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[3-[[7-[3-(2,2-ditert-butylpiperidin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 173170922 |
| Molecular Formula | C36H48FN7O3 |
| Molecular Weight | 645.82 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | 2-[3-[[7-[3-(2,2-ditert-butylpiperidin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2cc1OCCCN1CCCCC1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H48FN7O3/c1-34(2,3)36(35(4,5)6)14-8-9-15-44(36)16-11-17-47-30-22-28-27(21-29(30)46-7)33(39-23-38-28)41-31-19-26(42-43-31)20-32(45)40-25-13-10-12-24(37)18-25/h10,12-13,18-19,21-23H,8-9,11,14-17,20H2,1-7H3,(H,40,45)(H2,38,39,41,42,43) |
| InChIKey | KLSICFVHJRYURF-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.82 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|