C29H35FN7O7P — CID 10371979
2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate (PubChem CID 10371979) has the molecular formula C29H35FN7O7P and a molecular weight of 643.61 g/mol. Its IUPAC name is 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10371979 |
| Molecular Formula | C29H35FN7O7P |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
| SMILES | COc1cc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2cc1OCCCN(CCOP(=O)(O)O)C1CCC1 |
| InChI | InChI=1S/C29H35FN7O7P/c1-42-25-16-23-24(17-26(25)43-11-4-9-37(22-7-3-8-22)10-12-44-45(39,40)41)31-18-32-29(23)34-27-14-21(35-36-27)15-28(38)33-20-6-2-5-19(30)13-20/h2,5-6,13-14,16-18,22H,3-4,7-12,15H2,1H3,(H,33,38)(H2,39,40,41)(H2,31,32,34,35,36) |
| InChIKey | AKCXOKZYTAHASR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 184.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|