C29H34F2N7O6P — CID 10009384
2-[cyclopentyl-[3-[4-[[5-[2-(2,3-difluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate (PubChem CID 10009384) has the molecular formula C29H34F2N7O6P and a molecular weight of 645.60 g/mol. Its IUPAC name is 2-[cyclopentyl-[3-[4-[[5-[2-(2,3-difluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[cyclopentyl-[3-[4-[[5-[2-(2,3-difluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10009384 |
| Molecular Formula | C29H34F2N7O6P |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | 2-[cyclopentyl-[3-[4-[[5-[2-(2,3-difluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
| SMILES | O=C(Cc1cc(Nc2ncnc3cc(OCCCN(CCOP(=O)(O)O)C4CCCC4)ccc23)n[nH]1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C29H34F2N7O6P/c30-23-7-3-8-24(28(23)31)34-27(39)16-19-15-26(37-36-19)35-29-22-10-9-21(17-25(22)32-18-33-29)43-13-4-11-38(20-5-1-2-6-20)12-14-44-45(40,41)42/h3,7-10,15,17-18,20H,1-2,4-6,11-14,16H2,(H,34,39)(H2,40,41,42)(H2,32,33,35,36,37) |
| InChIKey | MESDAXRXXVEYPS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|